Information card for entry 1557414
| Chemical name |
[(1<i>R</i>*,3<i>S</i>*,4<i>S</i>*)-3-(2-Hydroxybenzoyl)-1,2,3,4-tetrahydro-1,4-epoxynaphthalen-1-yl]methyl 4-nitrobenzoate |
| Formula |
C25 H19 N O7 |
| Calculated formula |
C25 H19 N O7 |
| SMILES |
O1[C@@]2(C[C@@H]([C@H]1c1ccccc21)C(=O)c1c(O)cccc1)COC(=O)c1ccc(N(=O)=O)cc1.O1[C@]2(C[C@H]([C@@H]1c1ccccc21)C(=O)c1c(O)cccc1)COC(=O)c1ccc(N(=O)=O)cc1 |
| Title of publication |
[(1<i>R</i>*,3<i>S</i>*,4<i>S</i>*)-3-(2-Hydroxybenzoyl)-1,2,3,4-tetrahydro-1,4-epoxynaphthalen-1-yl]methyl 4-nitrobenzoate |
| Authors of publication |
Lough, Alan J.; Ho, Angel; Tam, William |
| Journal of publication |
IUCrData |
| Year of publication |
2020 |
| Journal volume |
5 |
| Journal issue |
2 |
| Pages of publication |
x200265 |
| a |
14.7455 ± 0.001 Å |
| b |
11.9504 ± 0.0008 Å |
| c |
11.9649 ± 0.0008 Å |
| α |
90° |
| β |
101.898 ± 0.002° |
| γ |
90° |
| Cell volume |
2063.1 ± 0.2 Å3 |
| Cell temperature |
150 ± 2 K |
| Ambient diffraction temperature |
150 ± 2 K |
| Number of distinct elements |
4 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/c 1 |
| Hall space group symbol |
-P 2ybc |
| Residual factor for all reflections |
0.0617 |
| Residual factor for significantly intense reflections |
0.0359 |
| Weighted residual factors for significantly intense reflections |
0.0821 |
| Weighted residual factors for all reflections included in the refinement |
0.093 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.011 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/1557414.html