Information card for entry 1558278
| Chemical name |
3-(pyridin-2-yl)triimidazo[1,2-a:1',2'-c:1'',2''-e][1,3,5]triazine |
| Formula |
C14 H9 N7 |
| Calculated formula |
C14 H9 N7 |
| SMILES |
n1cc(n2c3nccn3c3nccn3c12)c1ncccc1 |
| Title of publication |
Unravelling the intricated photophysical behavior of 3-(pyridin-2-yl)triimidazotriazine AIE and RTP polymorphs |
| Authors of publication |
Cariati, Elena; Lucenti, Elena; Forni, Alessandra; Previtali, Andrea; Marinotto, Daniele; Malpicci, Daniele; Righetto, Stefania; Giannini, Clelia; Virgili, Tersilla; Kabacinski, Piotr; Ganzer, Lucia; Giovanella, Umberto; Botta, Chiara |
| Journal of publication |
Chemical Science |
| Year of publication |
2020 |
| a |
18.0949 ± 0.0007 Å |
| b |
8.8509 ± 0.0004 Å |
| c |
17.3684 ± 0.0007 Å |
| α |
90° |
| β |
117.796 ± 0.001° |
| γ |
90° |
| Cell volume |
2460.69 ± 0.18 Å3 |
| Cell temperature |
293 ± 2 K |
| Ambient diffraction temperature |
293 ± 2 K |
| Number of distinct elements |
3 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/c 1 |
| Hall space group symbol |
-P 2ybc |
| Residual factor for all reflections |
0.0696 |
| Residual factor for significantly intense reflections |
0.0468 |
| Weighted residual factors for significantly intense reflections |
0.1245 |
| Weighted residual factors for all reflections included in the refinement |
0.1415 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.028 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
No |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/1558278.html