Information card for entry 1558680
| Formula |
C30 H28 O2 S |
| Calculated formula |
C30 H28 O2 S |
| SMILES |
S1(=O)(=O)c2cc(ccc2c2c1cc(cc2)c1c(cc(cc1C)C)C)c1c(cc(cc1C)C)C |
| Title of publication |
Structure-activity relationships in well-defined conjugated oligomer photocatalysts for hydrogen production from water |
| Authors of publication |
Aitchison, Catherine M.; Sachs, Michael; Little, Marc; Wilbraham, Liam; Brownbill, Nick J.; Kane, Chris; Blanc, Frédéric; Zwijnenburg, Martijn; Durrant, James; Sprick, Reiner Sebastian; Cooper, Andrew |
| Journal of publication |
Chemical Science |
| Year of publication |
2020 |
| a |
15.642 ± 0.005 Å |
| b |
17.335 ± 0.003 Å |
| c |
18.046 ± 0.003 Å |
| α |
90° |
| β |
98.641 ± 0.005° |
| γ |
90° |
| Cell volume |
4837.7 ± 1.9 Å3 |
| Cell temperature |
150 K |
| Ambient diffraction temperature |
150 K |
| Number of distinct elements |
4 |
| Space group number |
9 |
| Hermann-Mauguin space group symbol |
I 1 a 1 |
| Hall space group symbol |
I -2ya |
| Residual factor for all reflections |
0.1178 |
| Residual factor for significantly intense reflections |
0.0883 |
| Weighted residual factors for significantly intense reflections |
0.1966 |
| Weighted residual factors for all reflections included in the refinement |
0.2131 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.046 |
| Diffraction radiation probe |
x-ray |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
No |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/1558680.html