Information card for entry 1559018
| Chemical name |
<i>trans</i>-Diaquabis(<i>N</i>,<i>N</i>,<i>N</i>'-trimethylethylenediamine)nickel(II) dichloride |
| Formula |
C10 H32 Cl2 N4 Ni O2 |
| Calculated formula |
C10 H32 Cl2 N4 Ni O2 |
| SMILES |
C1C[NH](C)[Ni]2([N]1(C)C)([OH2])([N](CC[NH]2C)(C)C)[OH2].[Cl-].[Cl-] |
| Title of publication |
<i>trans</i>-Diaquabis(<i>N</i>,<i>N</i>,<i>N</i>'-trimethylethylenediamine)nickel(II) dichloride |
| Authors of publication |
Miecznikowski, John R.; Jasinski, Jerry P.; Flaherty, Nicole F.; Mircovich, Emma E.; Smolinsky, Allison N.; Bertolotti, Natalia R. |
| Journal of publication |
IUCrData |
| Year of publication |
2020 |
| Journal volume |
5 |
| Journal issue |
9 |
| Pages of publication |
x201182 |
| a |
24.7168 ± 0.0008 Å |
| b |
16.6156 ± 0.0005 Å |
| c |
8.3805 ± 0.0003 Å |
| α |
90° |
| β |
90° |
| γ |
90° |
| Cell volume |
3441.7 ± 0.2 Å3 |
| Cell temperature |
173 ± 2 K |
| Ambient diffraction temperature |
173 ± 2 K |
| Number of distinct elements |
6 |
| Space group number |
43 |
| Hermann-Mauguin space group symbol |
F d d 2 |
| Hall space group symbol |
F 2 -2d |
| Residual factor for all reflections |
0.0267 |
| Residual factor for significantly intense reflections |
0.025 |
| Weighted residual factors for significantly intense reflections |
0.0627 |
| Weighted residual factors for all reflections included in the refinement |
0.0636 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.032 |
| Diffraction radiation probe |
x-ray |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/1559018.html