Information card for entry 1559440
| Common name |
2-Benzoylamino-5-diethylamino-1,6,6alambda4-triselena-3,4-diazapentalene |
| Formula |
C14 H16 N4 O Se3 |
| Calculated formula |
C14 H N4 O Se3 |
| SMILES |
[Se]1[Se]2[Se]C(=NC=2N=C1N(CC)CC)NC(=O)c1ccccc1 |
| Title of publication |
Structure of 2-Benzoylamino-5-diethylamino-1,6,6alambda4-triselena-3,4-diazapentalene |
| Authors of publication |
Richter, Rainer; Sieler, Joachim; Hansen, Lars K.; Kohler, Ronald; Beyer, Lothar; Hoyer, Eberhard |
| Journal of publication |
Acta Chemica Scandinavica |
| Year of publication |
1991 |
| Journal volume |
45 |
| Pages of publication |
1 - 5 |
| a |
9.364 ± 0.001 Å |
| b |
11.723 ± 0.001 Å |
| c |
17.122 ± 0.002 Å |
| α |
90.903 ± 0.008° |
| β |
101.783 ± 0.009° |
| γ |
104.72 ± 0.009° |
| Cell volume |
1775 ± 0.3 Å3 |
| Ambient diffraction temperature |
293 K |
| Number of distinct elements |
5 |
| Space group number |
2 |
| Hermann-Mauguin space group symbol |
P -1 |
| Hall space group symbol |
-P 1 |
| Residual factor for significantly intense reflections |
0.036 |
| Diffraction radiation probe |
x-ray |
| Diffraction radiation wavelength |
0.71069 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
No |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/1559440.html
