Information card for entry 1559504
| Common name |
2,3-dihydro-2-oxo-3-phenyl-1,3-dithiolo[4,5-e][1,4]dithiin-6-thione |
| Formula |
C11 H6 O S5 |
| Calculated formula |
C11 O S5 |
| SMILES |
S1C(=S)SC2SC(C(=O)SC1=2)c1ccccc1 |
| Title of publication |
The Crystal Structures of Three Precursors to Organic Donors Based on BEDT‒TTF |
| Authors of publication |
Larsen, Sine; Thorsteinsson, Thorstein; Bowadt, Soren; Hansen, Thomas K.; Varma, Karikath S.; Becher, Jan; Underhill, Allan E. |
| Journal of publication |
Acta Chemica Scandinavica |
| Year of publication |
1991 |
| Journal volume |
45 |
| Pages of publication |
709 - 715 |
| a |
10.0792 ± 0.0013 Å |
| b |
6.059 ± 0.002 Å |
| c |
20.578 ± 0.005 Å |
| α |
90° |
| β |
105.87 ± 0.15° |
| γ |
90° |
| Cell volume |
1208.8 ± 1 Å3 |
| Ambient diffraction temperature |
110 K |
| Number of distinct elements |
4 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/c 1 |
| Hall space group symbol |
-P 2ybc |
| Residual factor for significantly intense reflections |
0.031 |
| Weighted residual factors for significantly intense reflections |
0.041 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.3 |
| Diffraction radiation probe |
x-ray |
| Diffraction radiation wavelength |
0.71069 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
No |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/1559504.html