Information card for entry 1559540
| Common name |
Tetrakis(2,2,6,6-tetramethyl-3,5-heptanedionato)cerium(IV) |
| Formula |
C44 H76 Ce O8 |
| Calculated formula |
C44 Ce O8 |
| SMILES |
[Ce]1234([O]=C(C(C)(C)C)C=C(O1)C(C)(C)C)([O]=C(C(C)(C)C)C=C(O2)C(C)(C)C)(OC(=CC(=[O]3)C(C)(C)C)C(C)(C)C)[O]=C(C(C)(C)C)C=C(O4)C(C)(C)C |
| Title of publication |
Structural and Thermal Studies of Tetrakis(2,2,6,6-tetramethyl-3,5-heptanedionato)cerium(IV) |
| Authors of publication |
Leskela, Markku; Sillanpaa, Reijo; Niinisto, Lauri; Tiitta, Marja |
| Journal of publication |
Acta Chemica Scandinavica |
| Year of publication |
1991 |
| Journal volume |
45 |
| Pages of publication |
1006 - 1011 |
| a |
12.4 ± 0.01 Å |
| b |
21.37 ± 0.02 Å |
| c |
37.89 ± 0.01 Å |
| α |
90° |
| β |
91.89 ± 0.06° |
| γ |
90° |
| Cell volume |
10035 ± 13 Å3 |
| Ambient diffraction temperature |
293 K |
| Number of distinct elements |
4 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/c 1 |
| Hall space group symbol |
-P 2ybc |
| Residual factor for significantly intense reflections |
0.096 |
| Weighted residual factors for significantly intense reflections |
0.105 |
| Diffraction radiation probe |
x-ray |
| Diffraction radiation wavelength |
0.71069 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
No |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/1559540.html