Information card for entry 1560122
| Common name |
vinpocetine oxalate |
| Formula |
C24 H28 N2 O6 |
| Calculated formula |
C24 H28 N2 O6 |
| SMILES |
n12c3[C@H]4[NH+](CCc3c3ccccc13)CCC[C@]4(C=C2C(=O)OCC)CC.C(=O)([O-])C(=O)O |
| Title of publication |
Mechanochemical reactivity inhibited, prohibited and reversed by liquid additives: examples from crystal-form screens |
| Authors of publication |
Arhangelskis, Mihails; Bučar, Dejan-Krešimir; Bordignon, Simone; Chierotti, Michele R.; Stratford, Samuel A.; Voinovich, Dario; Jones, William; Hasa, Dritan |
| Journal of publication |
Chemical Science |
| Year of publication |
2021 |
| Journal volume |
12 |
| Journal issue |
9 |
| Pages of publication |
3264 - 3269 |
| a |
18.5604 ± 0.0011 Å |
| b |
7.5949 ± 0.0004 Å |
| c |
8.0212 ± 0.0005 Å |
| α |
90° |
| β |
96.383 ± 0.005° |
| γ |
90° |
| Cell volume |
1123.69 ± 0.11 Å3 |
| Cell temperature |
293 K |
| Ambient diffraction temperature |
293 K |
| Number of distinct elements |
4 |
| Space group number |
4 |
| Hermann-Mauguin space group symbol |
P 1 21 1 |
| Hall space group symbol |
P 2yb |
| Residual factor R(I) for significantly intense reflections |
0.037 |
| Goodness-of-fit parameter for all reflections |
3.078 |
| Method of determination |
powder diffraction |
| Diffraction radiation wavelength |
1.5406 Å |
| Diffraction radiation type |
CuKα~1~ |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
No |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/1560122.html