Information card for entry 1561642
| Formula |
C21 H30 O3 |
| Calculated formula |
C21 H30 O3 |
| SMILES |
O=C1CCCC2=C1C[C@@H]1C[C@H]3C(CCCC(=O)[C@@H]3C[C@@]1(O2)C)(C)C.O=C1CCCC2=C1C[C@H]1C[C@@H]3C(CCCC(=O)[C@H]3C[C@]1(O2)C)(C)C |
| Title of publication |
Library construction of stereochemically diverse isomers of spirooliganin: their total synthesis and antiviral activity |
| Authors of publication |
Wang, Ru-Bing; Ma, Shuanggang; Jamieson, Cooper S.; Gao, Rong-Mei; Liu, Yunbao; Li, Yong; Wang, Xiaojing; Li, Yuhuan; Houk, Kendall N.; Qu, Jing; Yu, Shi-shan |
| Journal of publication |
Chemical Science |
| Year of publication |
2021 |
| a |
14.5922 ± 0.0001 Å |
| b |
15.5056 ± 0.0001 Å |
| c |
17.9599 ± 0.0001 Å |
| α |
104.166 ± 0.001° |
| β |
110.403 ± 0.001° |
| γ |
98.982 ± 0.001° |
| Cell volume |
3560.15 ± 0.06 Å3 |
| Cell temperature |
100 ± 2 K |
| Ambient diffraction temperature |
100 ± 2 K |
| Number of distinct elements |
3 |
| Space group number |
2 |
| Hermann-Mauguin space group symbol |
P -1 |
| Hall space group symbol |
-P 1 |
| Residual factor for all reflections |
0.0434 |
| Residual factor for significantly intense reflections |
0.0395 |
| Weighted residual factors for significantly intense reflections |
0.1046 |
| Weighted residual factors for all reflections included in the refinement |
0.1077 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.028 |
| Diffraction radiation wavelength |
1.54184 Å |
| Diffraction radiation type |
CuKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
No |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/1561642.html