Information card for entry 1564852
| Formula |
C30 H24 O3 Se2 |
| Calculated formula |
C30 H24 O3 Se2 |
| SMILES |
[Se](C([Se]c1ccccc1)=C(OC(=O)C(=O)c1ccc(cc1)C)c1ccc(cc1)C)c1ccccc1 |
| Title of publication |
2,2-Bis(phenylselanyl)-1-(p-tolyl)vinyl 2-Oxo-2-(p-tolyl)acetate |
| Authors of publication |
Kodama, Shintaro; Hung, Vu Thai; Saeki, Tomokazu; Mihara, Kei; Yamamoto, Yuki; Sonoda, Motohiro; Nomoto, Akihiro; Ogawa, Akiya |
| Journal of publication |
Molbank |
| Year of publication |
2021 |
| Journal volume |
2021 |
| Journal issue |
4 |
| Pages of publication |
M1283 |
| a |
9.62321 ± 0.00017 Å |
| b |
5.73648 ± 0.0001 Å |
| c |
45.1254 ± 0.0008 Å |
| α |
90° |
| β |
91.229 ± 0.006° |
| γ |
90° |
| Cell volume |
2490.5 ± 0.08 Å3 |
| Cell temperature |
123 K |
| Ambient diffraction temperature |
123 K |
| Number of distinct elements |
4 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/n 1 |
| Hall space group symbol |
-P 2yn |
| Residual factor for all reflections |
0.0308 |
| Residual factor for significantly intense reflections |
0.0264 |
| Weighted residual factors for significantly intense reflections |
0.0652 |
| Weighted residual factors for all reflections included in the refinement |
0.0672 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.054 |
| Diffraction radiation wavelength |
0.71075 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
No |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/1564852.html
