Information card for entry 1566718
| Chemical name |
(<i>E</i>)-5-(4-Methylbenzylidene)-1-phenyl-4,5,6,7-tetrahydro-1<i>H</i>-indazol-4-one |
| Formula |
C21 H18 N2 O |
| Calculated formula |
C21 H18 N2 O |
| SMILES |
Cc1ccc(/C=C/2CCc3c(C2=O)cnn3c2ccccc2)cc1 |
| Title of publication |
(<i>E</i>)-5-(4-Methylbenzylidene)-1-phenyl-4,5,6,7-tetrahydro-1<i>H</i>-indazol-4-one |
| Authors of publication |
Meenatchi, C. Selva; Athimoolam, S.; Suresh, J.; Priya, R. Vishnu; Rubina, S. Raja; Bhandari, S. R. |
| Journal of publication |
IUCrData |
| Year of publication |
2022 |
| Journal volume |
7 |
| Journal issue |
3 |
| Pages of publication |
x220283 |
| a |
30.3989 ± 0.0015 Å |
| b |
8.7177 ± 0.0005 Å |
| c |
14.0581 ± 0.0007 Å |
| α |
90° |
| β |
115.367 ± 0.002° |
| γ |
90° |
| Cell volume |
3366.3 ± 0.3 Å3 |
| Cell temperature |
293 ± 2 K |
| Ambient diffraction temperature |
293 ± 2 K |
| Number of distinct elements |
4 |
| Space group number |
15 |
| Hermann-Mauguin space group symbol |
C 1 2/c 1 |
| Hall space group symbol |
-C 2yc |
| Residual factor for all reflections |
0.0509 |
| Residual factor for significantly intense reflections |
0.0435 |
| Weighted residual factors for significantly intense reflections |
0.1148 |
| Weighted residual factors for all reflections included in the refinement |
0.1258 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.065 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/1566718.html