Information card for entry 2003064
| Common name |
I-TEMPO(a) |
| Chemical name |
4-(4-iodophenyl)methyleneamino-2,2,6,6-tetramethylpiperidin-1-oxyl |
| Formula |
C16 H22 I N2 O |
| Calculated formula |
C16 H22 I N2 O |
| SMILES |
Ic1ccc(/C=N/C2CC([N](=O)C(C2)(C)C)(C)C)cc1 |
| Title of publication |
TEMPO radicals showing magnetic interactions. I. 4-(4-Halobenzylideneamino)TEMPO and related compounds |
| Authors of publication |
Iwasaki, Fujiko; Yoshikawa, Joseph H.; Yamamoto, Hajime; Kan-nari, Eiji; Takada, Kiwamu; Yasui, Masanori; Ishida, Takayuki; Nogami, Takashi |
| Journal of publication |
Acta Crystallographica, Section B: Structural Science |
| Year of publication |
1999 |
| Journal volume |
55 |
| Journal issue |
2 |
| Pages of publication |
231 - 245 |
| a |
5.889 ± 0.004 Å |
| b |
25.851 ± 0.003 Å |
| c |
11.322 ± 0.003 Å |
| α |
90° |
| β |
105.27 ± 0.03° |
| γ |
90° |
| Cell volume |
1662.8 ± 1.3 Å3 |
| Cell temperature |
293 K |
| Ambient diffraction temperature |
293 K |
| Number of distinct elements |
5 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/c 1 |
| Hall space group symbol |
-P 2ybc |
| Residual factor for all reflections |
0.071 |
| Residual factor for significantly intense reflections |
0.0329 |
| Weighted residual factors for all reflections included in the refinement |
0.0945 |
| Goodness-of-fit parameter for all reflections included in the refinement |
0.992 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2003064.html