Information card for entry 2003234
| Chemical name |
6-ethyl-9-fluoro-6,7-dihydro-8-(4-hydroxy-1-piperidyl)-5-methyl-1-oxo-1H,5H- benzo[i,j]quinolizine-2-carboxylic acid |
| Formula |
C21 H25 F N2 O4 |
| Calculated formula |
C21 H25 F N2 O4 |
| SMILES |
Fc1cc2c(=O)c(cn3c2c(c1N1CCC(O)CC1)C[C@@H]([C@@H]3C)CC)C(=O)O.Fc1cc2c(=O)c(cn3c2c(c1N1CCC(O)CC1)C[C@H]([C@H]3C)CC)C(=O)O |
| Title of publication |
6-Ethyl-9-fluoro-6,7-dihydro-8-(4-hydroxy-piperidino)-5-methyl-1-oxo-1<i>H</i>,5<i>H</i>-benzo[<i>ij</i>]quinolizine-2-carboxylic Acid |
| Authors of publication |
Hashimoto, K.; Fujita, N.; Tanaka, T.; Kido, M. |
| Journal of publication |
Acta Crystallographica Section C |
| Year of publication |
1995 |
| Journal volume |
51 |
| Journal issue |
3 |
| Pages of publication |
519 - 521 |
| a |
15.387 ± 0.002 Å |
| b |
7.705 ± 0.002 Å |
| c |
16.013 ± 0.002 Å |
| α |
90° |
| β |
90° |
| γ |
90° |
| Cell volume |
1898.5 ± 0.6 Å3 |
| Cell temperature |
296 K |
| Ambient diffraction temperature |
296 K |
| Number of distinct elements |
5 |
| Space group number |
33 |
| Hermann-Mauguin space group symbol |
P n a 21 |
| Hall space group symbol |
P 2c -2n |
| Residual factor for significantly intense reflections |
0.036 |
| Weighted residual factors for significantly intense reflections |
0.04 |
| Goodness-of-fit parameter for significantly intense reflections |
1.2 |
| Diffraction radiation wavelength |
0.7107 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
No |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2003234.html