Information card for entry 2003255
| Chemical name |
3-(Trimethylsilyl)methyl Tetracylo[5.4.0.0^6,10^.0^9,11^] Undecan-4-yl 3,5-Dinitrobenzoate |
| Formula |
C22 H28 N2 O6 Si |
| Calculated formula |
C22 H28 N2 O6 Si |
| SMILES |
[Si](C[C@@H]1C[C@H]2[C@H]3[C@@H](C[C@H]1OC(=O)c1cc(N(=O)=O)cc(N(=O)=O)c1)[C@@H]1[C@H](C3)[C@H]21)(C)(C)C |
| Title of publication |
4-[(Trimethylsilyl)methyl]tetracyclo[5.4.0.0^6,10^.0^9,11^]undec-3-yl 3,5-Dinitrobenzoate |
| Authors of publication |
Lautens, M.; Lough, A. J.; Tam, W. |
| Journal of publication |
Acta Crystallographica Section C |
| Year of publication |
1995 |
| Journal volume |
51 |
| Journal issue |
3 |
| Pages of publication |
471 - 473 |
| a |
11.408 ± 0.002 Å |
| b |
11.495 ± 0.002 Å |
| c |
17.672 ± 0.004 Å |
| α |
90° |
| β |
90° |
| γ |
90° |
| Cell volume |
2317.4 ± 0.8 Å3 |
| Cell temperature |
293 ± 2 K |
| Ambient diffraction temperature |
293 ± 2 K |
| Number of distinct elements |
5 |
| Space group number |
19 |
| Hermann-Mauguin space group symbol |
P 21 21 21 |
| Hall space group symbol |
P 2ac 2ab |
| Residual factor for all reflections |
0.0988 |
| Residual factor for significantly intense reflections |
0.0483 |
| Weighted residual factors for all reflections |
0.1279 |
| Weighted residual factors for significantly intense reflections |
0.1092 |
| Goodness-of-fit parameter for all reflections |
1.024 |
| Goodness-of-fit parameter for significantly intense reflections |
1.113 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
No |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2003255.html