Information card for entry 2003390
| Chemical name |
4,6,7,9,10,12-hexahydrodithieno[3,2-c;2',3'-e][1,4,7]trioxacyclotridecine |
| Formula |
C14 H16 O3 S2 |
| Calculated formula |
C14 H16 O3 S2 |
| SMILES |
C1COCc2ccsc2c2c(COCCO1)ccs2 |
| Title of publication |
Five 3,3'-Bridged 2,2'-Dithiophenes |
| Authors of publication |
Pilati, T. |
| Journal of publication |
Acta Crystallographica Section C |
| Year of publication |
1995 |
| Journal volume |
51 |
| Journal issue |
4 |
| Pages of publication |
690 - 697 |
| a |
7.999 ± 0.001 Å |
| b |
12.06 ± 0.002 Å |
| c |
14.93 ± 0.002 Å |
| α |
90° |
| β |
102.46 ± 0.01° |
| γ |
90° |
| Cell volume |
1406.3 ± 0.4 Å3 |
| Cell temperature |
295 ± 2 K |
| Ambient diffraction temperature |
295 ± 2 K |
| Number of distinct elements |
4 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/n 1 |
| Hall space group symbol |
-P 2yn |
| Residual factor for significantly intense reflections |
0.035 |
| Weighted residual factors for significantly intense reflections |
0.046 |
| Goodness-of-fit parameter for significantly intense reflections |
2.024 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
No |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2003390.html