Information card for entry 2003473
| Chemical name |
ethyl 1,2,4,5-tetrahydro-3H,6H,10H-1-benzopyrano[9,9a,1-gh]quinolizin- 10-one-9-oate |
| Formula |
C18 H19 N O4 |
| Calculated formula |
C18 H19 N O4 |
| SMILES |
o1c(=O)c(cc2cc3c4c(c12)CCCN4CCC3)C(=O)OCC |
| Title of publication |
Coumarin 314 |
| Authors of publication |
Yip, B.-C.; Fun, H.-K.; Sivakumar, K.; Zhou, Z.-Y.; Shawkataly, O. B.; Teoh, S.-G. |
| Journal of publication |
Acta Crystallographica Section C |
| Year of publication |
1995 |
| Journal volume |
51 |
| Journal issue |
5 |
| Pages of publication |
956 - 958 |
| a |
8.532 ± 0.001 Å |
| b |
14.946 ± 0.001 Å |
| c |
12.022 ± 0.001 Å |
| α |
90° |
| β |
95.24 ± 0.01° |
| γ |
90° |
| Cell volume |
1526.6 ± 0.2 Å3 |
| Cell temperature |
293 ± 2 K |
| Ambient diffraction temperature |
293 ± 2 K |
| Number of distinct elements |
4 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/n 1 |
| Hall space group symbol |
-P 2yn |
| Residual factor for all reflections |
0.072 |
| Residual factor for significantly intense reflections |
0.0432 |
| Weighted residual factors for all reflections |
0.1322 |
| Weighted residual factors for significantly intense reflections |
0.1228 |
| Goodness-of-fit parameter for all reflections |
0.98 |
| Goodness-of-fit parameter for significantly intense reflections |
1.198 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
No |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2003473.html