Information card for entry 2003709
| Chemical name |
(4aRS,10aRS,10bRS)-Octahydro-1H,3H-pyrano[3',4':4,5]isoxazolo[2,3-a]pyridin- 1-one. |
| Formula |
C10 H15 N O3 |
| Calculated formula |
C10 H15 N O3 |
| SMILES |
[C@H]12ON3CCCC[C@@H]3[C@H]1C(=O)OCC2 |
| Title of publication |
Three Lactone Fused Perhydroisoxazolo[2,3-<i>a</i>]pyridines: a Conformational Study |
| Authors of publication |
Alvarez-Larena, A.; Piniella, J. F.; Cid, P.; de March, P.; Figueredo, M.; Font, J.; Milán, S.; Soria, A. |
| Journal of publication |
Acta Crystallographica Section C |
| Year of publication |
1995 |
| Journal volume |
51 |
| Journal issue |
7 |
| Pages of publication |
1314 - 1319 |
| a |
6.765 ± 0.003 Å |
| b |
8.93 ± 0.002 Å |
| c |
16.166 ± 0.005 Å |
| α |
90° |
| β |
90° |
| γ |
90° |
| Cell volume |
976.6 ± 0.6 Å3 |
| Cell temperature |
293 ± 2 K |
| Ambient diffraction temperature |
293 ± 2 K |
| Number of distinct elements |
4 |
| Space group number |
19 |
| Hermann-Mauguin space group symbol |
P 21 21 21 |
| Hall space group symbol |
P 2ac 2ab |
| Residual factor for all reflections |
0.0373 |
| Residual factor for significantly intense reflections |
0.0281 |
| Weighted residual factors for all reflections |
0.0779 |
| Weighted residual factors for significantly intense reflections |
0.0719 |
| Goodness-of-fit parameter for all reflections |
1.088 |
| Goodness-of-fit parameter for significantly intense reflections |
1.089 |
| Diffraction radiation wavelength |
0.70926 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
No |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2003709.html