Information card for entry 2003940
| Chemical name |
1-mésityl-3a-méthyl-5-phényl-3,3a,4,11-tétrahydro-3H-[1,2,4] oxadiazolo [4,5-a] [1,5] benzodiazépine |
| Formula |
C26 H25 N3 O |
| Calculated formula |
C26 H25 N3 O |
| SMILES |
Cc1cc(C)c(c(c1)C)C1=NO[C@]2(N1c1ccccc1N=C(C2)c1ccccc1)C |
| Title of publication |
1-Mésityl-3a-méthyl-5-phényl-3a,4-dihydro[1,2,4]oxadiazolo[4,5-<i>a</i>][1,5]benzodiazépine |
| Authors of publication |
Chiaroni, A.; Riche, C.; Baouid, A.; Benharref, A.; Hasnaoui, A.; Lavergne, J.-P. |
| Journal of publication |
Acta Crystallographica Section C |
| Year of publication |
1995 |
| Journal volume |
51 |
| Journal issue |
9 |
| Pages of publication |
1898 - 1900 |
| a |
8.521 ± 0.003 Å |
| b |
15.367 ± 0.006 Å |
| c |
16.892 ± 0.006 Å |
| α |
90° |
| β |
90° |
| γ |
90° |
| Cell volume |
2211.9 ± 1.4 Å3 |
| Cell temperature |
293 K |
| Ambient diffraction temperature |
293 K |
| Number of distinct elements |
4 |
| Space group number |
19 |
| Hermann-Mauguin space group symbol |
P 21 21 21 |
| Hall space group symbol |
P 2ac 2ab |
| Residual factor for significantly intense reflections |
0.056 |
| Weighted residual factors for significantly intense reflections |
0.063 |
| Goodness-of-fit parameter for significantly intense reflections |
1.02 |
| Diffraction radiation wavelength |
0.7107 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
No |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2003940.html