Information card for entry 2003970
| Chemical name |
N-(o-amidophenyl)-1,8-naphthoyleneimide |
| Formula |
C19 H12 N2 O3 |
| Calculated formula |
C19 H12 N2 O3 |
| SMILES |
O=C1N(C(=O)c2cccc3cccc1c23)c1c(cccc1)C(=O)N |
| Title of publication |
Benz[4,5]isoquino[1,2-<i>b</i>]quinazoline-7,9-dione and a Rearrangement Product of its Hydrolysis, 2-(1,8-Naphthalenedicarboximido)benzamide |
| Authors of publication |
Lindeman, S. V.; Ponomarev, I. I.; Rusanov, A. L. |
| Journal of publication |
Acta Crystallographica Section C |
| Year of publication |
1995 |
| Journal volume |
51 |
| Journal issue |
10 |
| Pages of publication |
2157 - 2161 |
| a |
9.354 ± 0.002 Å |
| b |
14.13 ± 0.003 Å |
| c |
11.923 ± 0.002 Å |
| α |
90° |
| β |
111.28 ± 0.03° |
| γ |
90° |
| Cell volume |
1468.4 ± 0.6 Å3 |
| Cell temperature |
173 ± 2 K |
| Ambient diffraction temperature |
173 ± 2 K |
| Number of distinct elements |
4 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/c 1 |
| Hall space group symbol |
-P 2ybc |
| Residual factor for all reflections |
0.0746 |
| Residual factor for significantly intense reflections |
0.0475 |
| Weighted residual factors for all reflections |
0.1357 |
| Weighted residual factors for significantly intense reflections |
0.1194 |
| Goodness-of-fit parameter for all reflections |
1.03 |
| Goodness-of-fit parameter for significantly intense reflections |
1.049 |
| Diffraction radiation wavelength |
0.71069 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
No |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2003970.html