Information card for entry 2004054
| Chemical name |
3-methyl-4H-pyrido[2,3-e]-1,2,4-thiadiazine 1,1-dioxide |
| Formula |
C7 H7 N3 O2 S |
| Calculated formula |
C7 H7 N3 O2 S |
| SMILES |
S1(=O)(=O)N=C(Nc2ncccc12)C |
| Title of publication |
3-Methyl-4<i>H</i>-pyrido[2,3-<i>e</i>]-1,2,4-thiadiazine 1,1-Dioxide |
| Authors of publication |
Dupont, L.; Pirotte, B.; de Tullio, P.; Masereel, B.; Delarge, J. |
| Journal of publication |
Acta Crystallographica Section C |
| Year of publication |
1995 |
| Journal volume |
51 |
| Journal issue |
10 |
| Pages of publication |
2064 - 2066 |
| a |
12.2439 ± 0.0012 Å |
| b |
10.6348 ± 0.0009 Å |
| c |
14.0329 ± 0.0013 Å |
| α |
90° |
| β |
117.964 ± 0.006° |
| γ |
90° |
| Cell volume |
1613.9 ± 0.3 Å3 |
| Cell temperature |
293 ± 2 K |
| Ambient diffraction temperature |
293 ± 2 K |
| Number of distinct elements |
5 |
| Space group number |
15 |
| Hermann-Mauguin space group symbol |
C 1 2/c 1 |
| Hall space group symbol |
-C 2yc |
| Residual factor for all reflections |
0.0324 |
| Residual factor for significantly intense reflections |
0.0284 |
| Weighted residual factors for all reflections |
0.0784 |
| Weighted residual factors for significantly intense reflections |
0.0769 |
| Goodness-of-fit parameter for all reflections |
1.034 |
| Goodness-of-fit parameter for significantly intense reflections |
1.084 |
| Diffraction radiation wavelength |
1.5418 Å |
| Diffraction radiation type |
CuKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2004054.html