Information card for entry 2004142
| Formula |
C17 H19 N3 O |
| Calculated formula |
C17 H19 N3 O |
| SMILES |
c1ccc(cc1)N/C(=N\c1ccccc1)N1CCOCC1 |
| Title of publication |
3,3-(Oxydiethyl)-1,2-diphenylguanidine |
| Authors of publication |
Sudha, L.; Senthil Selvan, J.; Subramanian, K.; Steiner, Th.; Koellner, G.; Srinivasan, N.; Ramdas, K. |
| Journal of publication |
Acta Crystallographica Section C |
| Year of publication |
1995 |
| Journal volume |
51 |
| Journal issue |
11 |
| Pages of publication |
2329 - 2331 |
| a |
9.211 ± 0.004 Å |
| b |
14.671 ± 0.004 Å |
| c |
11.533 ± 0.004 Å |
| α |
90° |
| β |
111.14 ± 0.04° |
| γ |
90° |
| Cell volume |
1453.6 ± 1 Å3 |
| Cell temperature |
294 K |
| Number of distinct elements |
4 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/c 1 |
| Hall space group symbol |
-P 2ybc |
| Residual factor for significantly intense reflections |
0.065 |
| Weighted residual factors for significantly intense reflections |
0.065 |
| Goodness-of-fit parameter for significantly intense reflections |
1.26 |
| Diffraction radiation wavelength |
1.54184 Å |
| Diffraction radiation type |
CuKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
No |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2004142.html