Information card for entry 2004179
| Chemical name |
2,4,7-Trimethyl-2,3-dihydro-4H-pyrido[4,3-e]-1,2,4-thiadiazinium 1,1-Dioxide Iodide |
| Formula |
C9 H14 I N3 O2 S |
| Calculated formula |
C9 H14 I N3 O2 S |
| SMILES |
[I-].S1(=O)(=O)N(CN(c2cc[n+](cc12)C)C)C |
| Title of publication |
2,4,7-Trimethyl-2,3-dihydro-4<i>H</i>-pyrido[4,3-<i>e</i>]-1,2,4-thiadiazinium 1,1-Dioxide Iodide |
| Authors of publication |
Dupont, L.; Pirotte, B.; de Tullio, P.; Diouf, O.; Masereel, B.; Delarge, J. |
| Journal of publication |
Acta Crystallographica Section C |
| Year of publication |
1995 |
| Journal volume |
51 |
| Journal issue |
11 |
| Pages of publication |
2412 - 2414 |
| a |
7.9184 ± 0.001 Å |
| b |
8.9446 ± 0.0014 Å |
| c |
10.861 ± 0.002 Å |
| α |
109.41 ± 0.009° |
| β |
107.918 ± 0.006° |
| γ |
90.336 ± 0.006° |
| Cell volume |
685.31 ± 0.19 Å3 |
| Cell temperature |
293 ± 2 K |
| Ambient diffraction temperature |
293 ± 2 K |
| Number of distinct elements |
6 |
| Space group number |
2 |
| Hermann-Mauguin space group symbol |
P -1 |
| Hall space group symbol |
-P 1 |
| Residual factor for all reflections |
0.0743 |
| Residual factor for significantly intense reflections |
0.0692 |
| Weighted residual factors for all reflections |
0.2008 |
| Weighted residual factors for significantly intense reflections |
0.1896 |
| Goodness-of-fit parameter for all reflections |
1.072 |
| Goodness-of-fit parameter for significantly intense reflections |
1.091 |
| Diffraction radiation wavelength |
1.5418 Å |
| Diffraction radiation type |
CuKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
No |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2004179.html