Information card for entry 2006171
| Common name |
meso-3,3'-bi(1,2,4-trithiacyclohex-5-enyl) |
| Formula |
C6 H6 S6 |
| Calculated formula |
C6 H6 S6 |
| SMILES |
C1=CS[C@@H](SS1)[C@H]1SSC=CS1 |
| Title of publication |
<i>meso</i>-3,3'-Bi(1,2,4-trithiacyclohex-5-enyl) |
| Authors of publication |
Shimizu, Toshio; Iwata, Kazuko; Kondo, Mitsuru; Kitagawa, Susumu; Kamigata, Nobumasa |
| Journal of publication |
Acta Crystallographica Section C |
| Year of publication |
1997 |
| Journal volume |
53 |
| Journal issue |
6 |
| Pages of publication |
748 - 749 |
| a |
8.111 ± 0.002 Å |
| b |
6.146 ± 0.001 Å |
| c |
10.242 ± 0.001 Å |
| α |
90° |
| β |
103.19 ± 0.01° |
| γ |
90° |
| Cell volume |
497.1 ± 0.16 Å3 |
| Cell temperature |
293 K |
| Ambient diffraction temperature |
293.2 K |
| Number of distinct elements |
3 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/c 1 |
| Hall space group symbol |
-P 2ybc |
| Residual factor for significantly intense reflections |
0.0286 |
| Weighted residual factors for significantly intense reflections |
0.0345 |
| Goodness-of-fit parameter for significantly intense reflections |
3.901 |
| Diffraction radiation wavelength |
0.7107 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
No |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2006171.html