Information card for entry 2006294
| Chemical name |
1,3-Diphenyl-2-tricyclo[3,3,1,1^3,7^]dec -2-ylidenepropane-1-imino-3-one |
| Formula |
C25 H25 N O |
| Calculated formula |
C25 H25 N O |
| SMILES |
O=C(/C(=C/1C2CC3CC1CC(C3)C2)C(=N)c1ccccc1)c1ccccc1 |
| Title of publication |
1,3-Diphenyl-2-tricyclo[3.3.1.1^3,7^]dec-2-ylidenepropane-1,3-diimine, and its -1-imino-3-one and -1,3-dione Derivatives |
| Authors of publication |
Ching-Fa Yao; Yuh-Shih Chen; Wen-Chang Chen; Ren-Shyang Sheu; Jen-Kou Lai; Chuen-Her Ueng |
| Journal of publication |
Acta Crystallographica Section C |
| Year of publication |
1997 |
| Journal volume |
53 |
| Journal issue |
7 |
| Pages of publication |
956 - 959 |
| a |
10.196 ± 0.001 Å |
| b |
15.478 ± 0.001 Å |
| c |
12.664 ± 0.003 Å |
| α |
90° |
| β |
106.36 ± 0.01° |
| γ |
90° |
| Cell volume |
1917.6 ± 0.5 Å3 |
| Cell temperature |
298 K |
| Ambient diffraction temperature |
298 K |
| Number of distinct elements |
4 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/c 1 |
| Hall space group symbol |
-P 2ybc |
| Residual factor for all reflections |
0.08 |
| Residual factor for significantly intense reflections |
0.043 |
| Weighted residual factors for all reflections |
0.034 |
| Weighted residual factors for significantly intense reflections |
0.033 |
| Goodness-of-fit parameter for significantly intense reflections |
2.8 |
| Diffraction radiation wavelength |
0.71069 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
No |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2006294.html
