Information card for entry 2006607
| Chemical name |
9-(2-phenylethyl)-3,3,6,6 tetramethyl-3,4,6,7,910-hexahydro-1,8(2H,5H) acridine dione |
| Formula |
C25 H31 N O2 |
| Calculated formula |
C25 H31 N O2 |
| SMILES |
O=C1CC(CC2=C1C(C1=C(CC(CC1=O)(C)C)N2)CCc1ccccc1)(C)C |
| Title of publication |
3,3,6,6-Tetramethyl-9-(2-phenylethyl)-3,4,6,7,9,10-hexahydro-1,8(2<i>H</i>,5<i>H</i>)-acridinedione |
| Authors of publication |
K. Gunasekaran; D. Velmurugan; P. Murugan |
| Journal of publication |
Acta Crystallographica Section C |
| Year of publication |
1997 |
| Journal volume |
53 |
| Journal issue |
10 |
| Pages of publication |
1512 - 1514 |
| a |
16.657 ± 0.001 Å |
| b |
7.351 ± 0.002 Å |
| c |
18.4 ± 0.002 Å |
| α |
90° |
| β |
108.3 ± 0.01° |
| γ |
90° |
| Cell volume |
2139.1 ± 0.7 Å3 |
| Cell temperature |
293 ± 2 K |
| Ambient diffraction temperature |
293 ± 2 K |
| Number of distinct elements |
4 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/c 1 |
| Hall space group symbol |
-P 2ybc |
| Residual factor for all reflections |
0.0583 |
| Residual factor for significantly intense reflections |
0.0515 |
| Weighted residual factors for all reflections |
0.1604 |
| Weighted residual factors for significantly intense reflections |
0.1386 |
| Goodness-of-fit parameter for all reflections |
1.066 |
| Goodness-of-fit parameter for significantly intense reflections |
1.096 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
No |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2006607.html