Information card for entry 2006870
| Chemical name |
(+)-(2S,3S,4S,5S)-(N-t-Butyloxycarbonyl)-2-benzyl-4,5-dimethyl- 3-hydroxy-pyrrolidine |
| Formula |
C18 H27 N O3 |
| Calculated formula |
C18 H27 N O3 |
| SMILES |
N1([C@H]([C@@H](O)[C@@H](C)[C@@H]1C)Cc1ccccc1)C(=O)OC(C)(C)C |
| Title of publication |
(+)-(2<i>S</i>,3<i>S</i>,4<i>S</i>,5<i>S</i>)-2-Benzyl-<i>N</i>-(<i>tert</i>-butyloxycarbonyl)-3-hydroxy-4,5-dimethylpyrrolidine at 143K |
| Authors of publication |
Bolte, Michael |
| Journal of publication |
Acta Crystallographica Section C |
| Year of publication |
1997 |
| Journal volume |
53 |
| Journal issue |
12 |
| Pages of publication |
IUC9700028 |
| a |
5.9054 ± 0.0008 Å |
| b |
9.2686 ± 0.0007 Å |
| c |
15.946 ± 0.002 Å |
| α |
90° |
| β |
97.138 ± 0.006° |
| γ |
90° |
| Cell volume |
866.04 ± 0.17 Å3 |
| Cell temperature |
143 K |
| Ambient diffraction temperature |
143 K |
| Number of distinct elements |
4 |
| Space group number |
4 |
| Hermann-Mauguin space group symbol |
P 1 21 1 |
| Hall space group symbol |
P 2yb |
| Residual factor for all reflections |
0.0369 |
| Residual factor for significantly intense reflections |
0.0362 |
| Weighted residual factors for all reflections |
0.0975 |
| Weighted residual factors for significantly intense reflections |
0.097 |
| Goodness-of-fit parameter for all reflections |
1.052 |
| Goodness-of-fit parameter for significantly intense reflections |
1.06 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2006870.html