Information card for entry 2007002
| Common name |
(pyrazolo[3,4-d]pyrimidin-1-yl)alkane |
| Chemical name |
1,3-bis(5-methyl-6-methylthio-4-oxo-1H-pyrazolo[3,4-d]pyrimidin-1-yl)propane |
| Formula |
C17 H20 N8 O2 S2 |
| Calculated formula |
C17 H20 N8 O2 S2 |
| SMILES |
S(c1n(C)c(=O)c2c(n1)n(nc2)CCCn1c2nc(SC)n(c(=O)c2cn1)C)C |
| Title of publication |
A Stacked Pyrazolo[3,4-<i>d</i>]pyrimidine-Based Flexible Molecule |
| Authors of publication |
Maulik, Prakas R.; Avasthi, Kamlakar; Biswas, Goutam; Biswas, Sampa; Rawat, Diwan S.; Sarkhel, Sanjay; Chandra, Tilak; Bhakuni, D. S. |
| Journal of publication |
Acta Crystallographica Section C |
| Year of publication |
1998 |
| Journal volume |
54 |
| Journal issue |
2 |
| Pages of publication |
275 - 277 |
| a |
13.459 ± 0.004 Å |
| b |
9.2087 ± 0.0015 Å |
| c |
15.883 ± 0.005 Å |
| α |
90° |
| β |
98.87 ± 0.04° |
| γ |
90° |
| Cell volume |
1945 ± 0.9 Å3 |
| Cell temperature |
293 ± 2 K |
| Ambient diffraction temperature |
293 ± 2 K |
| Number of distinct elements |
5 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/a 1 |
| Hall space group symbol |
-P 2yab |
| Residual factor for all reflections |
0.0851 |
| Residual factor for significantly intense reflections |
0.0404 |
| Weighted residual factors for all reflections |
0.1213 |
| Weighted residual factors for significantly intense reflections |
0.0993 |
| Goodness-of-fit parameter for all reflections |
0.956 |
| Goodness-of-fit parameter for significantly intense reflections |
1.117 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
No |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2007002.html