Information card for entry 2007458
| Chemical name |
cis,anti-7-phenyl-7a,8,9,10a-tetrahydro-6H,7H-furo[3',2':5,6]pyrano[3,2-c][1] benzopyran-6-one |
| Formula |
C20 H16 O4 |
| Calculated formula |
C20 H16 O4 |
| SMILES |
O1[C@@H]2[C@H]([C@@H](c3c(=O)oc4ccccc4c13)c1ccccc1)CCO2 |
| Title of publication |
Five 3,4-Dihydro-2<i>H</i>,5<i>H</i>-pyrano[3,2-<i>c</i>][1]benzopyran-5-one Derivatives |
| Authors of publication |
Casalone, Gianluigi; Pilati, Tullio; Binello, Arianna |
| Journal of publication |
Acta Crystallographica Section C |
| Year of publication |
1998 |
| Journal volume |
54 |
| Journal issue |
7 |
| Pages of publication |
1042 - 1047 |
| a |
8.664 ± 0.001 Å |
| b |
10.64 ± 0.002 Å |
| c |
8.822 ± 0.001 Å |
| α |
90° |
| β |
108.38 ± 0.01° |
| γ |
90° |
| Cell volume |
771.8 ± 0.2 Å3 |
| Cell temperature |
293 ± 2 K |
| Ambient diffraction temperature |
293 ± 2 K |
| Number of distinct elements |
3 |
| Space group number |
4 |
| Hermann-Mauguin space group symbol |
P 1 21 1 |
| Hall space group symbol |
P 2yb |
| Residual factor for all reflections |
0.074 |
| Residual factor for significantly intense reflections |
0.041 |
| Weighted residual factors for all reflections |
0.088 |
| Weighted residual factors for significantly intense reflections |
0.074 |
| Goodness-of-fit parameter for all reflections |
1.114 |
| Goodness-of-fit parameter for significantly intense reflections |
1.15 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
No |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2007458.html