Information card for entry 2007854
| Chemical name |
E-2,5-Bis(dimethyl)-3,4-diisopropyl-hexa-3-ene |
| Formula |
C16 H32 |
| Calculated formula |
C16 H32 |
| SMILES |
CC(/C(=C(/C(C)(C)C)C(C)C)C(C)C)(C)C |
| Title of publication |
(<i>E</i>)-3,4-Diisopropyl-2,5-dimethylhex-3-ene at 125K |
| Authors of publication |
Boese, Roland; Roth, Wolfgang R.; Bläser, Dieter; Latz, Rüdiger; Bäumen, Anja |
| Journal of publication |
Acta Crystallographica Section C |
| Year of publication |
1998 |
| Journal volume |
54 |
| Journal issue |
11 |
| Pages of publication |
IUC9800055 |
| a |
6.4252 ± 0.0009 Å |
| b |
8.6755 ± 0.0014 Å |
| c |
14.856 ± 0.003 Å |
| α |
73.359 ± 0.013° |
| β |
83.302 ± 0.013° |
| γ |
74.22 ± 0.012° |
| Cell volume |
762.8 ± 0.2 Å3 |
| Cell temperature |
125 ± 2 K |
| Ambient diffraction temperature |
125 ± 2 K |
| Number of distinct elements |
2 |
| Space group number |
2 |
| Hermann-Mauguin space group symbol |
P -1 |
| Hall space group symbol |
-P 1 |
| Residual factor for all reflections |
0.071 |
| Residual factor for significantly intense reflections |
0.0466 |
| Weighted residual factors for all reflections included in the refinement |
0.124 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.053 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
No |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2007854.html