Information card for entry 2007933
| Chemical name |
1,10-phenanthrolinium bis(pyrocatecholato-O,O')borate |
| Formula |
C24 H17 B N2 O4 |
| Calculated formula |
C24 H17 B N2 O4 |
| SMILES |
[B-]12(Oc3c(O1)cccc3)Oc1c(O2)cccc1.[nH+]1cccc2ccc3cccnc3c12 |
| Title of publication |
Salts of the Bis(catecholato)borate Anion with Organic Cations |
| Authors of publication |
Clegg, William; Scott, Andrew J.; Lawlor, Fiona J.; Norman, Nicholas C.; Marder, Todd B.; Dai, Chaoyang; Nguyen, Paul |
| Journal of publication |
Acta Crystallographica Section C |
| Year of publication |
1998 |
| Journal volume |
54 |
| Journal issue |
12 |
| Pages of publication |
1875 - 1880 |
| a |
16.12 ± 0.002 Å |
| b |
15.959 ± 0.002 Å |
| c |
14.9294 ± 0.0019 Å |
| α |
90° |
| β |
90° |
| γ |
90° |
| Cell volume |
3840.7 ± 0.8 Å3 |
| Cell temperature |
160 ± 2 K |
| Ambient diffraction temperature |
160 ± 2 K |
| Number of distinct elements |
5 |
| Space group number |
60 |
| Hermann-Mauguin space group symbol |
P b c n |
| Hall space group symbol |
-P 2n 2ab |
| Residual factor for all reflections |
0.095 |
| Residual factor for significantly intense reflections |
0.055 |
| Weighted residual factors for all reflections included in the refinement |
0.177 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.025 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
No |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2007933.html