Information card for entry 2007988
| Chemical name |
2,5-Cyclohexadiene-1,4-dione,3-(methylamino)-5-[(1,2,3,4,4a,7,8, 8a-octahydro-1,2,4a,5-tetramethyl-1-naphthalenyl)methyl] 4'-METHYLAMINO AVARONE |
| Formula |
C22 H31 N O2 |
| Calculated formula |
C22 H31 N O2 |
| SMILES |
O=C1C(=CC(=O)C(=C1)NC)C[C@@]1([C@H](CC[C@@]2(C(=CCC[C@@H]12)C)C)C)C |
| Title of publication |
4'-Methylaminoavarone from <i>Dysidea avara</i> |
| Authors of publication |
Puliti, Raffaella; De Rosa, Salvatore; Mattia, Carlo Andrea |
| Journal of publication |
Acta Crystallographica Section C |
| Year of publication |
1998 |
| Journal volume |
54 |
| Journal issue |
12 |
| Pages of publication |
1954 - 1957 |
| a |
7.204 ± 0.0013 Å |
| b |
7.6076 ± 0.0011 Å |
| c |
35.187 ± 0.009 Å |
| α |
90° |
| β |
90° |
| γ |
90° |
| Cell volume |
1928.4 ± 0.7 Å3 |
| Cell temperature |
293 K |
| Ambient diffraction temperature |
293 K |
| Number of distinct elements |
4 |
| Space group number |
19 |
| Hermann-Mauguin space group symbol |
P 21 21 21 |
| Hall space group symbol |
P 2ac 2ab |
| Residual factor for all reflections |
0.0509 |
| Residual factor for significantly intense reflections |
0.0447 |
| Weighted residual factors for significantly intense reflections |
0.0443 |
| Goodness-of-fit parameter for significantly intense reflections |
0.927 |
| Diffraction radiation wavelength |
1.54056 Å |
| Diffraction radiation type |
CuKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
No |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2007988.html