Information card for entry 2008022
| Chemical name |
(1S^*^,3S^*^)-3-methoxy-1-methyl-3-phenyl-3-(1,1,1-trimethylsilyl)-propyl 3,5-dinitrobenzoate. |
| Formula |
C21 H26 N2 O7 Si |
| Calculated formula |
C21 H26 N2 O7 Si |
| SMILES |
[Si]([C@@](OC)(C[C@@H](OC(=O)c1cc(N(=O)=O)cc(N(=O)=O)c1)C)c1ccccc1)(C)(C)C.[Si]([C@](OC)(C[C@H](OC(=O)c1cc(N(=O)=O)cc(N(=O)=O)c1)C)c1ccccc1)(C)(C)C |
| Title of publication |
A Dinitrobenzoate Derivative of an α-Methoxy-γ-hydroxysilane |
| Authors of publication |
Baudoux, Guy; Norberg, Bernadette; Bousbaa, Jamal; Krief, Alain; Evrard, Guy |
| Journal of publication |
Acta Crystallographica Section C |
| Year of publication |
1998 |
| Journal volume |
54 |
| Journal issue |
12 |
| Pages of publication |
1944 - 1945 |
| a |
32.421 ± 0.003 Å |
| b |
6.235 ± 0.001 Å |
| c |
22.646 ± 0.001 Å |
| α |
90° |
| β |
91.333 ± 0.007° |
| γ |
90° |
| Cell volume |
4576.5 ± 0.9 Å3 |
| Cell temperature |
292 ± 2 K |
| Ambient diffraction temperature |
292 ± 2 K |
| Number of distinct elements |
5 |
| Space group number |
15 |
| Hermann-Mauguin space group symbol |
C 1 2/c 1 |
| Hall space group symbol |
-C 2yc |
| Residual factor for all reflections |
0.0478 |
| Residual factor for significantly intense reflections |
0.0402 |
| Weighted residual factors for all reflections included in the refinement |
0.1215 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.11 |
| Diffraction radiation wavelength |
1.54178 Å |
| Diffraction radiation type |
CuKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2008022.html