Information card for entry 2008178
| Formula |
C21 H24 N2 O3 |
| Calculated formula |
C10.5 H12 N O1.5 |
| SMILES |
O1CCOc2ccccc2/C=N/CCC/N=C/c2c(OCC1)cccc2 |
| Title of publication |
2,5,8-Trioxa-16,20-diazatricyclo[20.4.0.0^9,14^]hexacosa-9,11,13,15,20,22,24,26-octaene |
| Authors of publication |
Hökelek, Tuncer; Kılıç, Zeynel; Bilge, Selen |
| Journal of publication |
Acta Crystallographica Section C |
| Year of publication |
1999 |
| Journal volume |
55 |
| Journal issue |
2 |
| Pages of publication |
248 - 250 |
| a |
14.901 ± 0.002 Å |
| b |
15.785 ± 0.001 Å |
| c |
8.012 ± 0.002 Å |
| α |
90° |
| β |
98.67 ± 0.02° |
| γ |
90° |
| Cell volume |
1863 ± 0.6 Å3 |
| Cell temperature |
298 K |
| Number of distinct elements |
4 |
| Space group number |
15 |
| Hermann-Mauguin space group symbol |
C 1 2/c 1 |
| Hall space group symbol |
-C 2yc |
| Residual factor for significantly intense reflections |
0.0691 |
| Weighted residual factors for significantly intense reflections |
0.075 |
| Goodness-of-fit parameter for significantly intense reflections |
1.15 |
| Diffraction radiation wavelength |
0.71069 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
No |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2008178.html
