Information card for entry 2008347
| Common name |
(+/-)-10a-Carboxy-1,9,10,10a-tetrahydrophenanthren-3(2H)-one |
| Chemical name |
(+/-)-10a-Carboxy-1,9,10,10a-tetrahydrophenanthren-3(2H)-one |
| Formula |
C15 H14 O3 |
| Calculated formula |
C15 H14 O3 |
| SMILES |
O=C1CCC2(C(=C1)c1ccccc1CC2)C(=O)O |
| Title of publication |
(±)-3-Oxo-1,2,3,9,10,10a-hexahydrophenanthrene-10a-carboxylic acid: catemeric hydrogen bonding in a δ-keto acid |
| Authors of publication |
Miller, Alan J.; Brunskill, Andrew P. J.; Lalancette, Roger A.; Thompson, Hugh W. |
| Journal of publication |
Acta Crystallographica Section C |
| Year of publication |
1999 |
| Journal volume |
55 |
| Journal issue |
4 |
| Pages of publication |
563 - 566 |
| a |
9.305 ± 0.002 Å |
| b |
12.78 ± 0.003 Å |
| c |
10.444 ± 0.003 Å |
| α |
90° |
| β |
101.79 ± 0.02° |
| γ |
90° |
| Cell volume |
1215.8 ± 0.5 Å3 |
| Cell temperature |
293 ± 2 K |
| Ambient diffraction temperature |
293 ± 2 K |
| Number of distinct elements |
3 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/n 1 |
| Hall space group symbol |
-P 2yn |
| Residual factor for all reflections |
0.123 |
| Residual factor for significantly intense reflections |
0.059 |
| Weighted residual factors for all reflections |
0.138 |
| Weighted residual factors for significantly intense reflections |
0.109 |
| Goodness-of-fit parameter for all reflections |
1.04 |
| Goodness-of-fit parameter for significantly intense reflections |
1.16 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
No |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2008347.html