Information card for entry 2008403
| Chemical name |
1-Allyl-3-(ethoxycarbonylmethylen)-2-oxo-1,2,3,4-tetrahydroquinoxaline |
| Formula |
C15 H16 N2 O3 |
| Calculated formula |
C15 H16 N2 O3 |
| SMILES |
N1\C(=C/C(=O)OCC)C(=O)N(CC=C)c2ccccc12 |
| Title of publication |
Ethyl 4-allyl-4-oxo-1,2,3,4-tetrahydroquinoxalin-2-ylideneacetate |
| Authors of publication |
Sersra, Souad; Essassi, El-Mokhtar; El-Bali, Brahim; Bolte, Michael |
| Journal of publication |
Acta Crystallographica Section C |
| Year of publication |
1999 |
| Journal volume |
55 |
| Journal issue |
4 |
| Pages of publication |
IUC9900021 |
| a |
9.222 ± 0.005 Å |
| b |
9.365 ± 0.005 Å |
| c |
16.728 ± 0.009 Å |
| α |
90° |
| β |
104.62 ± 0.01° |
| γ |
90° |
| Cell volume |
1397.9 ± 1.3 Å3 |
| Cell temperature |
173 ± 2 K |
| Ambient diffraction temperature |
173 ± 2 K |
| Number of distinct elements |
4 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/c 1 |
| Hall space group symbol |
-P 2ybc |
| Residual factor for all reflections |
0.127 |
| Residual factor for significantly intense reflections |
0.055 |
| Weighted residual factors for all reflections included in the refinement |
0.135 |
| Goodness-of-fit parameter for all reflections included in the refinement |
0.994 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2008403.html