Information card for entry 2008408
| Chemical name |
perfluoro-benzocyclobutene |
| Formula |
C8 F8 |
| Calculated formula |
C8 F8 |
| SMILES |
c12c(c(c(c(c1F)F)F)F)C(F)(F)C2(F)F |
| Title of publication |
2,3,4,5,7,7,8,8,-Octafluorobicyclo[4.2.0]octa-1,3,5-triene at 125K |
| Authors of publication |
Boese, Roland; Bläser, Dieter; Latz, Rüdiger; Bäumen, Anja |
| Journal of publication |
Acta Crystallographica Section C |
| Year of publication |
1999 |
| Journal volume |
55 |
| Journal issue |
4 |
| Pages of publication |
IUC9900036 |
| a |
8.6226 ± 0.0016 Å |
| b |
8.6226 ± 0.0016 Å |
| c |
21.73 ± 0.005 Å |
| α |
90° |
| β |
90° |
| γ |
90° |
| Cell volume |
1615.6 ± 0.6 Å3 |
| Cell temperature |
125 ± 2 K |
| Ambient diffraction temperature |
125 ± 2 K |
| Number of distinct elements |
2 |
| Space group number |
88 |
| Hermann-Mauguin space group symbol |
I 41/a :2 |
| Hall space group symbol |
-I 4ad |
| Residual factor for all reflections |
0.074 |
| Residual factor for significantly intense reflections |
0.063 |
| Weighted residual factors for all reflections included in the refinement |
0.2 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.075 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
No |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2008408.html