Information card for entry 2008491
| Chemical name |
10β-Hydroxy-6α-(3,4,5-trimethoxyphenyl)-2,3,6,6aα,7,9,9aβ,10- octahydroisobenzofuro[5,6-g][1,4]benzodioxin-7-one |
| Formula |
C23 H24 O8 |
| Calculated formula |
C23 H24 O8 |
| SMILES |
O=C1OC[C@H]2[C@@H](O)c3cc4OCCOc4cc3[C@@H]([C@H]12)c1cc(OC)c(OC)c(OC)c1.O=C1OC[C@@H]2[C@H](O)c3cc4OCCOc4cc3[C@H]([C@@H]12)c1cc(OC)c(OC)c(OC)c1 |
| Title of publication |
10β-Hydroxy-6α-(3,4,5-trimethoxyphenyl)-2,3,6,6aα,7,9,9aβ,10-octahydroisobenzofuro[5,6-<i>g</i>][1,4]benzodioxin-7-one |
| Authors of publication |
A. Sergi Capilla; M. Dolors Pujol; Xavier Solans; Mercè Font-Bardia |
| Journal of publication |
Acta Crystallographica Section C |
| Year of publication |
1999 |
| Journal volume |
55 |
| Journal issue |
5 |
| Pages of publication |
786 - 787 |
| a |
8.608 ± 0.003 Å |
| b |
10.393 ± 0.004 Å |
| c |
12.455 ± 0.005 Å |
| α |
109.36 ± 0.04° |
| β |
102.24 ± 0.03° |
| γ |
92.1 ± 0.03° |
| Cell volume |
1020.4 ± 0.7 Å3 |
| Cell temperature |
293 ± 2 K |
| Ambient diffraction temperature |
293 ± 2 K |
| Number of distinct elements |
3 |
| Space group number |
2 |
| Hermann-Mauguin space group symbol |
P -1 |
| Hall space group symbol |
-P 1 |
| Residual factor for all reflections |
0.067 |
| Residual factor for significantly intense reflections |
0.057 |
| Weighted residual factors for all reflections included in the refinement |
0.141 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.044 |
| Diffraction radiation wavelength |
0.71069 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2008491.html