Information card for entry 2008661
| Chemical name |
3,12-Diaza-6,9-diazoniadispiro[5.2.5.2]hexadecane dichloride |
| Formula |
C12 H26 Cl2 N4 |
| Calculated formula |
C12 H26 Cl2 N4 |
| SMILES |
C1C[N+]2(CCN1)CC[N+]1(CCNCC1)CC2.[Cl-].[Cl-] |
| Title of publication |
3,12-Diaza-6,9-diazoniadispiro[5.2.5.2]hexadecane dichloride from X-ray powder data |
| Authors of publication |
Chernyshev, Vladimir V.; Yatsenko, Alexandr V.; Tafeenko, Victor A.; Makarov, Vadim A.; Sonneveld, Eduard J.; Schenk, Hendrik |
| Journal of publication |
Acta Crystallographica Section C |
| Year of publication |
1999 |
| Journal volume |
55 |
| Journal issue |
7 |
| Pages of publication |
1099 - 1101 |
| a |
9.684 ± 0.003 Å |
| b |
9.479 ± 0.003 Å |
| c |
8.156 ± 0.003 Å |
| α |
90° |
| β |
95.33 ± 0.02° |
| γ |
90° |
| Cell volume |
745.4 ± 0.4 Å3 |
| Cell temperature |
295 ± 2 K |
| Ambient diffraction temperature |
295 ± 2 K |
| Number of distinct elements |
4 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/n 1 |
| Hall space group symbol |
-P 2yn |
| Goodness-of-fit parameter for all reflections |
2.33 |
| Diffraction radiation wavelength |
1.54059 Å |
| Diffraction radiation type |
CuKα~1~ |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
No |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2008661.html