Information card for entry 2008700
| Common name |
exo-[(RS,SR)-N,N'-Bis(salicylidene)-2,3-butanediaminato]oxovanadium(IV) |
| Formula |
C18 H18 N2 O3 V |
| Calculated formula |
C18 H18 N2 O3 V |
| SMILES |
c12ccccc2C=[N]2[V]3(=O)(O1)Oc1c(C=[N]3[C@H]([C@H]2C)C)cccc1 |
| Title of publication |
<i>exo</i>-[(<i>RS</i>,<i>SR</i>)-<i>N</i>,<i>N</i>'-Bis(salicylidene)-2,3-butanediaminato]oxovanadium(IV) |
| Authors of publication |
Hoshina, Gakuse; Tsuchimoto, Masanobu; Ohba, Shigeru |
| Journal of publication |
Acta Crystallographica Section C |
| Year of publication |
1999 |
| Journal volume |
55 |
| Journal issue |
7 |
| Pages of publication |
1082 - 1084 |
| a |
10.796 ± 0.003 Å |
| b |
7.755 ± 0.002 Å |
| c |
19.315 ± 0.002 Å |
| α |
90° |
| β |
90.8 ± 0.01° |
| γ |
90° |
| Cell volume |
1617 ± 0.6 Å3 |
| Cell temperature |
297 K |
| Ambient diffraction temperature |
273.2 K |
| Number of distinct elements |
5 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/c 1 |
| Hall space group symbol |
-P 2ybc |
| Residual factor for all reflections |
0.061 |
| Residual factor for significantly intense reflections |
0.036 |
| Weighted residual factors for all reflections included in the refinement |
0.064 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.262 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
No |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2008700.html