Information card for entry 2008757
| Chemical name |
3,4,5,6,7,8-hexahydro-10,10-dimethyl-1,2,8-thiadiazecin-9(10H)-one 1,1-dioxide |
| Formula |
C9 H18 N2 O3 S |
| Calculated formula |
C9 H18 N2 O3 S |
| SMILES |
S1(=O)(=O)NCCCCCNC(=O)C1(C)C |
| Title of publication |
10,10-Dimethyl-1,2,8-thiadiazecan-9-one 1,1-dioxide |
| Authors of publication |
Linden, Anthony; Todorova, Tonya R.; Heimgartner, Heinz |
| Journal of publication |
Acta Crystallographica Section C |
| Year of publication |
1999 |
| Journal volume |
55 |
| Journal issue |
8 |
| Pages of publication |
1378 - 1380 |
| a |
5.6804 ± 0.0015 Å |
| b |
11.117 ± 0.002 Å |
| c |
8.7621 ± 0.0008 Å |
| α |
90° |
| β |
94.27 ± 0.013° |
| γ |
90° |
| Cell volume |
551.78 ± 0.18 Å3 |
| Cell temperature |
173 ± 1 K |
| Ambient diffraction temperature |
173 ± 1 K |
| Number of distinct elements |
5 |
| Space group number |
4 |
| Hermann-Mauguin space group symbol |
P 1 21 1 |
| Hall space group symbol |
P 2yb |
| Residual factor for all reflections |
0.028 |
| Residual factor for significantly intense reflections |
0.027 |
| Weighted residual factors for all reflections included in the refinement |
0.072 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.062 |
| Diffraction radiation wavelength |
0.71069 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2008757.html