Information card for entry 2008967
| Chemical name |
(2S,3S,9S,10S)-2,3,9,10-Tetraphenyl-1,4,8,11-tetraoxacyclotetradecane-6,13-dione |
| Formula |
C34 H32 O6 |
| Calculated formula |
C34 H32 O6 |
| SMILES |
O=C1CO[C@@H](c2ccccc2)[C@@H](OCC(=O)CO[C@H]([C@@H](OC1)c1ccccc1)c1ccccc1)c1ccccc1 |
| Title of publication |
Cocrystallization of two conformers of (2<i>S</i>,3<i>S</i>,9<i>S</i>,10<i>S</i>)-2,3,9,10-tetraphenyl-1,4,8,11-tetraoxacyclotetradecane-6,13-dione |
| Authors of publication |
Choong Eui Song; Yang Hee Kim; Kwan Mook Kim; Dae Yoon Chi; Jong Hwa Jeong |
| Journal of publication |
Acta Crystallographica Section C |
| Year of publication |
1999 |
| Journal volume |
55 |
| Journal issue |
9 |
| Pages of publication |
1574 - 1575 |
| a |
14.945 ± 0.002 Å |
| b |
14.945 ± 0.002 Å |
| c |
39.572 ± 0.002 Å |
| α |
90° |
| β |
90° |
| γ |
90° |
| Cell volume |
8838.5 ± 1.7 Å3 |
| Cell temperature |
293 ± 2 K |
| Ambient diffraction temperature |
293 ± 2 K |
| Number of distinct elements |
3 |
| Space group number |
96 |
| Hermann-Mauguin space group symbol |
P 43 21 2 |
| Hall space group symbol |
P 4nw 2abw |
| Residual factor for all reflections |
0.1353 |
| Residual factor for significantly intense reflections |
0.0468 |
| Weighted residual factors for all reflections included in the refinement |
0.1496 |
| Goodness-of-fit parameter for all reflections included in the refinement |
0.999 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
No |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2008967.html