Information card for entry 2008997
| Chemical name |
(4-(N-pyridiniummethyl)-1,3-dioxolane)-2-spiro-1',2',4',6' -trinitrocyclohexadienide |
| Formula |
C14 H12 N4 O8 |
| Calculated formula |
C14 H12 N4 O8 |
| SMILES |
N(=O)(=O)C1=C[C-](N(=O)=O)C=C(N(=O)=O)C21OC(CO2)C[n+]1ccccc1 |
| Title of publication |
A zwitterionic Meisenheimer complex of 2,4,6-trinitrobenzene |
| Authors of publication |
Borbulevych, Oleg Ya.; Shishkin, Oleg V.; Knyazev, Victor N. |
| Journal of publication |
Acta Crystallographica Section C |
| Year of publication |
1999 |
| Journal volume |
55 |
| Journal issue |
10 |
| Pages of publication |
1704 - 1706 |
| a |
13.336 ± 0.003 Å |
| b |
13.837 ± 0.003 Å |
| c |
16.059 ± 0.004 Å |
| α |
90° |
| β |
98.51 ± 0.02° |
| γ |
90° |
| Cell volume |
2930.7 ± 1.2 Å3 |
| Cell temperature |
193 ± 2 K |
| Ambient diffraction temperature |
193 ± 2 K |
| Number of distinct elements |
4 |
| Space group number |
15 |
| Hermann-Mauguin space group symbol |
C 1 2/c 1 |
| Hall space group symbol |
-C 2yc |
| Residual factor for all reflections |
0.0715 |
| Residual factor for significantly intense reflections |
0.0442 |
| Weighted residual factors for all reflections |
0.1408 |
| Weighted residual factors for all reflections included in the refinement |
0.118 |
| Goodness-of-fit parameter for all reflections |
0.991 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.103 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
No |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2008997.html