Information card for entry 2009109
| Chemical name |
3'-(2,3-Dimethyl-5-oxo-1-phenyl-3-pyrazolin-4-yl) Spiro (5-fluoro-3H-indol-3,2'-thiazolidine)-2,4'-(1H)-dione |
| Formula |
C21 H17 F N4 O3 S |
| Calculated formula |
C21 H17 F N4 O3 S |
| SMILES |
S1C2(N(C(=O)C1)c1c(n(n(c1=O)c1ccccc1)C)C)C(=O)Nc1ccc(F)cc21 |
| Title of publication |
3'-(2,3-Dimethyl-5-oxo-1-phenyl-3-pyrazolin-4-yl)-5-fluorospiro[3<i>H</i>-indole-3,2'-thiazolidine]-2(1<i>H</i>),4'-dione |
| Authors of publication |
Jain, Subhash C.; Sinha, Juhi; Bhagat, Sunita; Babu, B. Ravindra; Bali, Shilpika |
| Journal of publication |
Acta Crystallographica Section C |
| Year of publication |
1999 |
| Journal volume |
55 |
| Journal issue |
11 |
| Pages of publication |
1826 - 1829 |
| a |
10.1159 ± 0.0005 Å |
| b |
15.5291 ± 0.0007 Å |
| c |
13.363 ± 0.0006 Å |
| α |
90° |
| β |
110.744 ± 0.001° |
| γ |
90° |
| Cell volume |
1963.12 ± 0.16 Å3 |
| Cell temperature |
180 ± 2 K |
| Ambient diffraction temperature |
180 ± 2 K |
| Number of distinct elements |
6 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/n 1 |
| Hall space group symbol |
-P 2yn |
| Residual factor for all reflections |
0.053 |
| Residual factor for significantly intense reflections |
0.037 |
| Weighted residual factors for all reflections |
0.097 |
| Weighted residual factors for significantly intense reflections |
0.09 |
| Goodness-of-fit parameter for all reflections |
1.03 |
| Goodness-of-fit parameter for significantly intense reflections |
1.094 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2009109.html