Information card for entry 2009220
| Chemical name |
Spiro(4,8-dibenzyl-1,3-dioxaazulenium-2,1'-2',4',6'-trinitrohexadienide) |
| Formula |
C27 H19 N3 O8 |
| Calculated formula |
C27 H19 N3 O8 |
| SMILES |
N(=O)(=O)C1=C[C-](N(=O)=O)C=C(N(=O)=O)C21OC1C(=CC=C[C+](C=1O2)Cc1ccccc1)Cc1ccccc1 |
| Title of publication |
4,8-Dibenzyl-2',4',6'-trinitrospiro[1,3-dioxaazulenium-2,1'-cyclohexadienide] |
| Authors of publication |
Borbulevych, Oleg Ya.; Antipin, Michail Yu.; Olekhnovich, Lev P. |
| Journal of publication |
Acta Crystallographica Section C |
| Year of publication |
1999 |
| Journal volume |
55 |
| Journal issue |
12 |
| Pages of publication |
2177 - 2179 |
| a |
9.311 ± 0.005 Å |
| b |
12.877 ± 0.007 Å |
| c |
19.806 ± 0.01 Å |
| α |
90° |
| β |
94.74 ± 0.04° |
| γ |
90° |
| Cell volume |
2367 ± 2 Å3 |
| Cell temperature |
193 ± 2 K |
| Ambient diffraction temperature |
193 ± 2 K |
| Number of distinct elements |
4 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/n 1 |
| Hall space group symbol |
-P 2yn |
| Residual factor for all reflections |
0.1537 |
| Residual factor for significantly intense reflections |
0.0719 |
| Weighted residual factors for all reflections |
0.1659 |
| Weighted residual factors for all reflections included in the refinement |
0.1211 |
| Goodness-of-fit parameter for all reflections |
0.998 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.225 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2009220.html