Information card for entry 2009288
| Chemical name |
3,28-Dimethoxy-3,11,28-trioxo-2,3-seco-18β-olean-12-en-2,9α-olide |
| Formula |
C32 H46 O7 |
| Calculated formula |
C32 H46 O7 |
| SMILES |
O=C(OC)C([C@@H]1CC[C@@]2([C@]3(OC(=O)C[C@@]13C)C(=O)C=C1[C@]2(CC[C@@]2([C@H]1CC(CC2)(C)C)C(=O)OC)C)C)(C)C |
| Title of publication |
Triterpenoide. XVII. 3,28-Dimethoxy-3,11,28-trioxo-2,3-seco-18β-olean-12-en-2,9α-olid |
| Authors of publication |
Gzella, Andrzej |
| Journal of publication |
Acta Crystallographica Section C |
| Year of publication |
1999 |
| Journal volume |
55 |
| Journal issue |
12 |
| Pages of publication |
2151 - 2153 |
| a |
29.143 ± 0.004 Å |
| b |
7.456 ± 0.002 Å |
| c |
14.855 ± 0.002 Å |
| α |
90° |
| β |
116.33 ± 0.02° |
| γ |
90° |
| Cell volume |
2893 ± 1.1 Å3 |
| Cell temperature |
293 ± 2 K |
| Ambient diffraction temperature |
293 ± 2 K |
| Number of distinct elements |
3 |
| Space group number |
5 |
| Hermann-Mauguin space group symbol |
C 1 2 1 |
| Hall space group symbol |
C 2y |
| Residual factor for all reflections |
0.04 |
| Residual factor for significantly intense reflections |
0.033 |
| Weighted residual factors for all reflections included in the refinement |
0.095 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.038 |
| Diffraction radiation wavelength |
1.54178 Å |
| Diffraction radiation type |
CuKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
No |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2009288.html