Information card for entry 2009312
| Chemical name |
4-[4-Acetyloxy-3,5,6-trimethyl-1-[4-nitrobenzoyl]oxy-2-yl]butan-2-one |
| Formula |
C22 H23 N O7 |
| Calculated formula |
C22 H23 N O7 |
| SMILES |
O(c1c(c(c(OC(=O)C)c(c1C)C)C)CCC(=O)C)C(=O)c1ccc(N(=O)=O)cc1 |
| Title of publication |
4-Acetoxy-3,5,6-trimethyl-2-(3-oxobutyl)phenyl 4-nitrobenzoate |
| Authors of publication |
Prabhakar, C.; Vyas, K.; Moses Babu, J.; Sarma, M. R.; Om Reddy, G. |
| Journal of publication |
Acta Crystallographica Section C |
| Year of publication |
1999 |
| Journal volume |
55 |
| Journal issue |
12 |
| Pages of publication |
IUC9900160 |
| a |
12.186 ± 0.001 Å |
| b |
8.7763 ± 0.0009 Å |
| c |
20.4128 ± 0.0009 Å |
| α |
90° |
| β |
104.593 ± 0.004° |
| γ |
90° |
| Cell volume |
2112.7 ± 0.3 Å3 |
| Cell temperature |
298.2 K |
| Ambient diffraction temperature |
298.2 K |
| Number of distinct elements |
4 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/c 1 |
| Hall space group symbol |
-P 2ybc |
| Residual factor for all reflections |
0.0619 |
| Residual factor for significantly intense reflections |
0.0482 |
| Weighted residual factors for all reflections |
0.0836 |
| Weighted residual factors for all reflections included in the refinement |
0.0797 |
| Goodness-of-fit parameter for all reflections |
1.799 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.931 |
| Diffraction radiation wavelength |
1.5418 Å |
| Diffraction radiation type |
CuKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2009312.html