Information card for entry 2009651
| Formula |
C10 H8 O6 |
| Calculated formula |
C10 H8 O6 |
| SMILES |
O1C(=O)C=C[C@@]21O[C@@]1(OC(=O)C=C1)COC2.O1C(=O)C=C[C@]21O[C@]1(OC(=O)C=C1)COC2 |
| Title of publication |
2,9-Dioxo-1,6,8,13-tetraoxadispiro[4.1.4.3]tetradeca-3,10-diene, C~10~H~8~O~6~ |
| Authors of publication |
Cottier, L.; Descotes, G.; Eymard, L.; Faure, R. |
| Journal of publication |
Acta Crystallographica Section C |
| Year of publication |
1994 |
| Journal volume |
50 |
| Journal issue |
4 |
| Pages of publication |
625 - 627 |
| a |
8.048 ± 0.001 Å |
| b |
8.398 ± 0.001 Å |
| c |
15.918 ± 0.002 Å |
| α |
101.54 ± 0.01° |
| β |
98.88 ± 0.01° |
| γ |
106.62 ± 0.01° |
| Cell volume |
984.1 ± 0.2 Å3 |
| Cell temperature |
291 K |
| Number of distinct elements |
3 |
| Space group number |
2 |
| Hermann-Mauguin space group symbol |
P -1 |
| Hall space group symbol |
-P 1 |
| Residual factor for significantly intense reflections |
0.058 |
| Weighted residual factors for significantly intense reflections |
0.057 |
| Goodness-of-fit parameter for significantly intense reflections |
0.61 |
| Diffraction radiation wavelength |
1.5424 Å |
| Diffraction radiation type |
CuKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
No |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2009651.html