Information card for entry 2010139
| Chemical name |
3,6-dibromo-1,4-dihydro-1,4-di(p-methoxyphenyl)-1,2,4,5-tetrazine |
| Formula |
C16 H14 Br2 N4 O2 |
| Calculated formula |
C16 H14 Br2 N4 O2 |
| SMILES |
COc1ccc(cc1)n1nc(Br)n(nc1Br)c1ccc(cc1)OC |
| Title of publication |
Two heterocyclic 1,2,4,5-tetrazines |
| Authors of publication |
Ueng, C.-H.; Wang, Y.; Yeh, M.-Y. |
| Journal of publication |
Acta Crystallographica Section C |
| Year of publication |
1994 |
| Journal volume |
50 |
| Journal issue |
11 |
| Pages of publication |
1781 - 1784 |
| a |
18.975 ± 0.003 Å |
| b |
10.327 ± 0.002 Å |
| c |
8.569 ± 0.003 Å |
| α |
90° |
| β |
90° |
| γ |
90° |
| Cell volume |
1679.1 ± 0.7 Å3 |
| Cell temperature |
298 K |
| Number of distinct elements |
5 |
| Hermann-Mauguin space group symbol |
P b c n |
| Hall space group symbol |
-P 2n 2ab |
| Residual factor for significantly intense reflections |
0.037 |
| Weighted residual factors for significantly intense reflections |
0.028 |
| Goodness-of-fit parameter for significantly intense reflections |
2.28 |
| Diffraction radiation wavelength |
0.7107 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
No |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2010139.html