Information card for entry 2010163
| Chemical name |
2-[2-(2'-hydroxy-1'-oxo-1',2',3',4'-tetrahydronaphthyl)ethyl]-1,2,3,4- tetrahydronaphthylone thiosemicarbazone |
| Formula |
C23 H25 N3 O2 S |
| Calculated formula |
C23 H25 N3 O2 S |
| SMILES |
S=C(N/N=C1\[C@H](CCc2ccccc12)CC[C@@]1(O)C(=O)c2ccccc2CC1)N.S=C(N/N=C1\[C@@H](CCc2ccccc12)CC[C@]1(O)C(=O)c2ccccc2CC1)N |
| Title of publication |
A novel bistetrahydronaphthyl thiosemicarbazone |
| Authors of publication |
Yang, Jian; Pandeya, S.N.; Dimmock, Jonathan R.; Quail, J. Wilson |
| Journal of publication |
Acta Crystallographica Section C |
| Year of publication |
1994 |
| Journal volume |
50 |
| Journal issue |
11 |
| Pages of publication |
1828 - 1830 |
| a |
10.492 ± 0.004 Å |
| b |
13.048 ± 0.003 Å |
| c |
15.595 ± 0.002 Å |
| α |
90° |
| β |
99.54 ± 0.03° |
| γ |
90° |
| Cell volume |
2105.4 ± 1 Å3 |
| Cell temperature |
289 K |
| Ambient diffraction temperature |
289 K |
| Number of distinct elements |
5 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/a 1 |
| Hall space group symbol |
-P 2yab |
| Residual factor for all reflections |
0.074 |
| Residual factor for significantly intense reflections |
0.049 |
| Weighted residual factors for all reflections |
0.05 |
| Weighted residual factors for significantly intense reflections |
0.05 |
| Goodness-of-fit parameter for significantly intense reflections |
2.47 |
| Diffraction radiation wavelength |
0.7093 Å |
| Diffraction radiation type |
MolybdenumKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
No |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2010163.html