Information card for entry 2010665
| Chemical name |
2,3,3a,4,5a,6,7,8-Octahydro-5a-methyl-6,9-methano-1H,9H-5-oxa-4-azacyclo- penta[c]indene |
| Formula |
C12 H15 N O |
| Calculated formula |
C12 H15 N O |
| SMILES |
O1N=C2[C@@]3([C@]1([C@H]1C=C[C@@H]3C1)C)CCC2.O1N=C2[C@]3([C@@]1([C@@H]1C=C[C@H]3C1)C)CCC2 |
| Title of publication |
2,3,3a,4,5a,6,7,8-Octahydro-5a-methyl-6,9-methano-1<i>H</i>,9<i>H</i>-5-oxa-4-azacyclopenta[<i>c</i>]indene |
| Authors of publication |
Tam, William; Handerson, Sean; Ferguson, George |
| Journal of publication |
Acta Crystallographica Section C |
| Year of publication |
2000 |
| Journal volume |
56 |
| Journal issue |
2 |
| Pages of publication |
e71 - e71 |
| a |
7.64 ± 0.002 Å |
| b |
12.7121 ± 0.0014 Å |
| c |
10.2205 ± 0.0007 Å |
| α |
90° |
| β |
91.668 ± 0.011° |
| γ |
90° |
| Cell volume |
992.2 ± 0.3 Å3 |
| Cell temperature |
294 ± 1 K |
| Ambient diffraction temperature |
294 ± 1 K |
| Number of distinct elements |
4 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/n 1 |
| Hall space group symbol |
-P 2yn |
| Residual factor for all reflections |
0.0668 |
| Residual factor for significantly intense reflections |
0.0442 |
| Weighted residual factors for all reflections included in the refinement |
0.109 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.044 |
| Diffraction radiation wavelength |
0.7107 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2010665.html